C7H14N2O — CID 129260438
2-(ethylamino)pent-4-enamide (PubChem CID 129260438) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-(ethylamino)pent-4-enamide.
| Compound Name | 2-(ethylamino)pent-4-enamide |
|---|---|
| PubChem CID | 129260438 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-(ethylamino)pent-4-enamide |
| SMILES | C=CCC(NCC)C(N)=O |
| InChI | InChI=1S/C7H14N2O/c1-3-5-6(7(8)10)9-4-2/h3,6,9H,1,4-5H2,2H3,(H2,8,10) |
| InChIKey | NNZGMEDPSTUVRJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|