C17H28N2O3 — CID 129260491
(Z,3R)-6-ethenyl-3-[2-(ethylamino)pent-4-enoylamino]oct-6-enoic acid (PubChem CID 129260491) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is (Z,3R)-6-ethenyl-3-[2-(ethylamino)pent-4-enoylamino]oct-6-enoic acid.
| Compound Name | (Z,3R)-6-ethenyl-3-[2-(ethylamino)pent-4-enoylamino]oct-6-enoic acid |
|---|---|
| PubChem CID | 129260491 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (Z,3R)-6-ethenyl-3-[2-(ethylamino)pent-4-enoylamino]oct-6-enoic acid |
| SMILES | C=CCC(NCC)C(=O)N[C@H](CC/C(C=C)=C/C)CC(=O)O |
| InChI | InChI=1S/C17H28N2O3/c1-5-9-15(18-8-4)17(22)19-14(12-16(20)21)11-10-13(6-2)7-3/h5-7,14-15,18H,1-2,8-12H2,3-4H3,(H,19,22)(H,20,21)/b13-7+/t14-,15?/m1/s1 |
| InChIKey | BLAOUCCWIMHIGE-KTSHKMAVSA-N |
| XLogP | 2.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|