About ethane;ethene;(Z)-4-ethenylhex-4-enoic acid
ethane;ethene;(Z)-4-ethenylhex-4-enoic acid (PubChem CID 177225786) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;ethene;(Z)-4-ethenylhex-4-enoic acid.
Molecular Properties
| Compound Name | ethane;ethene;(Z)-4-ethenylhex-4-enoic acid |
| PubChem CID | 177225786 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;ethene;(Z)-4-ethenylhex-4-enoic acid |
| SMILES | C=C.C=C/C(=C\C)CCC(=O)O.CC |
| InChI | InChI=1S/C8H12O2.C2H6.C2H4/c1-3-7(4-2)5-6-8(9)10;2*1-2/h3-4H,1,5-6H2,2H3,(H,9,10);1-2H3;1-2H2/b7-4+;; |
| InChIKey | PIIAVQRYLPWHNZ-RDRKJGRWSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;(Z)-4-ethenylhex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;(Z)-4-ethenylhex-4-enoic acid?
The IUPAC name of ethane;ethene;(Z)-4-ethenylhex-4-enoic acid (CID 177225786) is ethane;ethene;(Z)-4-ethenylhex-4-enoic acid.
What is the SMILES notation for ethane;ethene;(Z)-4-ethenylhex-4-enoic acid?
The canonical SMILES for ethane;ethene;(Z)-4-ethenylhex-4-enoic acid is C=C.C=C/C(=C\C)CCC(=O)O.CC.
What is the InChIKey of ethane;ethene;(Z)-4-ethenylhex-4-enoic acid?
The InChIKey is PIIAVQRYLPWHNZ-RDRKJGRWSA-N. The full InChI is InChI=1S/C8H12O2.C2H6.C2H4/c1-3-7(4-2)5-6-8(9)10;2*1-2/h3-4H,1,5-6H2,2H3,(H,9,10);1-2H3;1-2H2/b7-4+;;.
What are the key properties of ethane;ethene;(Z)-4-ethenylhex-4-enoic acid?
ethane;ethene;(Z)-4-ethenylhex-4-enoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;(Z)-4-ethenylhex-4-enoic acid is sourced from PubChem (CID 177225786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).