C10H14FmNO3- — CID 165115773
aminomethanone;(4Z)-4-ethenylhepta-4,6-dienoic acid;fermium (PubChem CID 165115773) has the molecular formula C10H14FmNO3- and a molecular weight of 453.23 g/mol. Its IUPAC name is aminomethanone;(4Z)-4-ethenylhepta-4,6-dienoic acid;fermium.
| Compound Name | aminomethanone;(4Z)-4-ethenylhepta-4,6-dienoic acid;fermium |
|---|---|
| PubChem CID | 165115773 |
| Molecular Formula | C10H14FmNO3- |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | aminomethanone;(4Z)-4-ethenylhepta-4,6-dienoic acid;fermium |
| SMILES | C=C/C=C(\C=C)CCC(=O)O.N[C-]=O.[Fm] |
| InChI | InChI=1S/C9H12O2.CH2NO.Fm/c1-3-5-8(4-2)6-7-9(10)11;2-1-3;/h3-5H,1-2,6-7H2,(H,10,11);(H2,2,3);/q;-1;/b8-5+;; |
| InChIKey | ASISHNDFKYCDEL-RMZRELHQSA-N |
| XLogP | 1.16 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|