C14H23NO2S — CID 170770358
2-amino-4-[(5Z)-5-ethenylocta-5,7-dienyl]sulfanylbutanoic acid (PubChem CID 170770358) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-amino-4-[(5Z)-5-ethenylocta-5,7-dienyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[(5Z)-5-ethenylocta-5,7-dienyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770358 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-amino-4-[(5Z)-5-ethenylocta-5,7-dienyl]sulfanylbutanoic acid |
| SMILES | C=C/C=C(\C=C)CCCCSCCC(N)C(=O)O |
| InChI | InChI=1S/C14H23NO2S/c1-3-7-12(4-2)8-5-6-10-18-11-9-13(15)14(16)17/h3-4,7,13H,1-2,5-6,8-11,15H2,(H,16,17)/b12-7+ |
| InChIKey | QAOWAZDJVZIBCP-KPKJPENVSA-N |
| XLogP | 2.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|