C9H19N — CID 144901462
ethane;(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular hydrogen (PubChem CID 144901462) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is ethane;(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular hydrogen.
| Compound Name | ethane;(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 144901462 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | ethane;(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)CN.CC.[H][H] |
| InChI | InChI=1S/C7H11N.C2H6.H2/c1-3-5-7(4-2)6-8;1-2;/h3-5H,1-2,6,8H2;1-2H3;1H/b7-5+;; |
| InChIKey | LISGVKSBGXINSS-WVKUUHRJSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|