C13H25NO — CID 142945417
(4Z)-2-amino-4-ethenylhepta-4,6-dienal;ethane (PubChem CID 142945417) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4Z)-2-amino-4-ethenylhepta-4,6-dienal;ethane.
| Compound Name | (4Z)-2-amino-4-ethenylhepta-4,6-dienal;ethane |
|---|---|
| PubChem CID | 142945417 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4Z)-2-amino-4-ethenylhepta-4,6-dienal;ethane |
| SMILES | C=C/C=C(\C=C)CC(N)C=O.CC.CC |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-3-5-8(4-2)6-9(10)7-11;2*1-2/h3-5,7,9H,1-2,6,10H2;2*1-2H3/b8-5+;; |
| InChIKey | VISFQHICNRJUMI-RMZRELHQSA-N |
| XLogP | 3.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|