C14H27NO3 — CID 163388832
(4Z,6E)-2-amino-4-ethenyl-7-hydroxyocta-4,6-dienoic acid;ethane (PubChem CID 163388832) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (4Z,6E)-2-amino-4-ethenyl-7-hydroxyocta-4,6-dienoic acid;ethane.
| Compound Name | (4Z,6E)-2-amino-4-ethenyl-7-hydroxyocta-4,6-dienoic acid;ethane |
|---|---|
| PubChem CID | 163388832 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (4Z,6E)-2-amino-4-ethenyl-7-hydroxyocta-4,6-dienoic acid;ethane |
| SMILES | C=C/C(=C\C=C(/C)O)CC(N)C(=O)O.CC.CC |
| InChI | InChI=1S/C10H15NO3.2C2H6/c1-3-8(5-4-7(2)12)6-9(11)10(13)14;2*1-2/h3-5,9,12H,1,6,11H2,2H3,(H,13,14);2*1-2H3/b7-4+,8-5+;; |
| InChIKey | FJUCVGWYFLDZMB-PZOTUAEBSA-N |
| XLogP | 3.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|