C29H37NO5 — CID 163388840
ethane;(4Z,6E)-4-ethenyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxyocta-4,6-dienoic acid (PubChem CID 163388840) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is ethane;(4Z,6E)-4-ethenyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxyocta-4,6-dienoic acid.
| Compound Name | ethane;(4Z,6E)-4-ethenyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxyocta-4,6-dienoic acid |
|---|---|
| PubChem CID | 163388840 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | ethane;(4Z,6E)-4-ethenyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxyocta-4,6-dienoic acid |
| SMILES | C=C/C(=C\C=C(/C)O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CC.CC |
| InChI | InChI=1S/C25H25NO5.2C2H6/c1-3-17(13-12-16(2)27)14-23(24(28)29)26-25(30)31-15-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22;2*1-2/h3-13,22-23,27H,1,14-15H2,2H3,(H,26,30)(H,28,29);2*1-2H3/b16-12+,17-13+;; |
| InChIKey | RILCAXFZPRFOMO-AZMAMVBESA-N |
| XLogP | 6.99 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|