C10H15NO2 — CID 146649344
(2R,4Z,5Z)-2-amino-4-ethylideneocta-5,7-dienoic acid (PubChem CID 146649344) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (2R,4Z,5Z)-2-amino-4-ethylideneocta-5,7-dienoic acid.
| Compound Name | (2R,4Z,5Z)-2-amino-4-ethylideneocta-5,7-dienoic acid |
|---|---|
| PubChem CID | 146649344 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2R,4Z,5Z)-2-amino-4-ethylideneocta-5,7-dienoic acid |
| SMILES | C=C/C=C\C(=C/C)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H15NO2/c1-3-5-6-8(4-2)7-9(11)10(12)13/h3-6,9H,1,7,11H2,2H3,(H,12,13)/b6-5-,8-4+/t9-/m1/s1 |
| InChIKey | SNRGXESSRZZCDI-XYKKWEGESA-N |
| XLogP | 1.48 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|