C11H16O — CID 143072769
(4Z,5Z)-4-ethylidene-2-methylocta-5,7-dienal (PubChem CID 143072769) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (4Z,5Z)-4-ethylidene-2-methylocta-5,7-dienal.
| Compound Name | (4Z,5Z)-4-ethylidene-2-methylocta-5,7-dienal |
|---|---|
| PubChem CID | 143072769 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (4Z,5Z)-4-ethylidene-2-methylocta-5,7-dienal |
| SMILES | C=C/C=C\C(=C/C)CC(C)C=O |
| InChI | InChI=1S/C11H16O/c1-4-6-7-11(5-2)8-10(3)9-12/h4-7,9-10H,1,8H2,2-3H3/b7-6-,11-5+ |
| InChIKey | VVRYQCAXPRJJOG-TUKAJDRUSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|