C10H16 — CID 123347446
7-methyl-5-methylideneocta-1,3-diene (PubChem CID 123347446) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 7-methyl-5-methylideneocta-1,3-diene.
| Compound Name | 7-methyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 123347446 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 7-methyl-5-methylideneocta-1,3-diene |
| SMILES | C=CC=CC(=C)CC(C)C |
| InChI | InChI=1S/C10H16/c1-5-6-7-10(4)8-9(2)3/h5-7,9H,1,4,8H2,2-3H3 |
| InChIKey | KNYJVIYCWCYHCO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|