C12H23I — CID 143199544
ethane;(3Z)-6-methyl-5-methylideneocta-1,3-diene;hydroiodide (PubChem CID 143199544) has the molecular formula C12H23I and a molecular weight of 294.22 g/mol. Its IUPAC name is ethane;(3Z)-6-methyl-5-methylideneocta-1,3-diene;hydroiodide.
| Compound Name | ethane;(3Z)-6-methyl-5-methylideneocta-1,3-diene;hydroiodide |
|---|---|
| PubChem CID | 143199544 |
| Molecular Formula | C12H23I |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethane;(3Z)-6-methyl-5-methylideneocta-1,3-diene;hydroiodide |
| SMILES | C=C/C=C\C(=C)C(C)CC.CC.I |
| InChI | InChI=1S/C10H16.C2H6.HI/c1-5-7-8-10(4)9(3)6-2;1-2;/h5,7-9H,1,4,6H2,2-3H3;1-2H3;1H/b8-7-;; |
| InChIKey | PLHORZWKODINFC-OTMFCZTRSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|