C20H38 — CID 178166429
ethane;(3Z)-8,8,9-trimethyl-5-methylidene-6-propan-2-ylundeca-1,3-diene (PubChem CID 178166429) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is ethane;(3Z)-8,8,9-trimethyl-5-methylidene-6-propan-2-ylundeca-1,3-diene.
| Compound Name | ethane;(3Z)-8,8,9-trimethyl-5-methylidene-6-propan-2-ylundeca-1,3-diene |
|---|---|
| PubChem CID | 178166429 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | ethane;(3Z)-8,8,9-trimethyl-5-methylidene-6-propan-2-ylundeca-1,3-diene |
| SMILES | C=C/C=C\C(=C)C(CC(C)(C)C(C)CC)C(C)C.CC |
| InChI | InChI=1S/C18H32.C2H6/c1-9-11-12-15(5)17(14(3)4)13-18(7,8)16(6)10-2;1-2/h9,11-12,14,16-17H,1,5,10,13H2,2-4,6-8H3;1-2H3/b12-11-; |
| InChIKey | HNYPZXCIMHVWTI-AFEZEDKISA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|