C16H34 — CID 153402313
4,4-dimethylpent-1-ene;3,3,4-trimethylhexane (PubChem CID 153402313) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 4,4-dimethylpent-1-ene;3,3,4-trimethylhexane.
| Compound Name | 4,4-dimethylpent-1-ene;3,3,4-trimethylhexane |
|---|---|
| PubChem CID | 153402313 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 4,4-dimethylpent-1-ene;3,3,4-trimethylhexane |
| SMILES | C=CCC(C)(C)C.CCC(C)C(C)(C)CC |
| InChI | InChI=1S/C9H20.C7H14/c1-6-8(3)9(4,5)7-2;1-5-6-7(2,3)4/h8H,6-7H2,1-5H3;5H,1,6H2,2-4H3 |
| InChIKey | DJIANXNUXZNAKL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|