C14H24 — CID 145089593
(3Z,5E)-5-(2,3-dimethylbutan-2-yl)octa-1,3,5-triene (PubChem CID 145089593) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (3Z,5E)-5-(2,3-dimethylbutan-2-yl)octa-1,3,5-triene.
| Compound Name | (3Z,5E)-5-(2,3-dimethylbutan-2-yl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 145089593 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3Z,5E)-5-(2,3-dimethylbutan-2-yl)octa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/CC)C(C)(C)C(C)C |
| InChI | InChI=1S/C14H24/c1-7-9-11-13(10-8-2)14(5,6)12(3)4/h7,9-12H,1,8H2,2-6H3/b11-9-,13-10+ |
| InChIKey | KPUOQKCUJWTKFL-SZJZEYKYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|