C15H24O6 — CID 174911104
bis(prop-2-enoic acid);3,3,4-trimethyl-2-methylidenepentanoic acid (PubChem CID 174911104) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is bis(prop-2-enoic acid);3,3,4-trimethyl-2-methylidenepentanoic acid.
| Compound Name | bis(prop-2-enoic acid);3,3,4-trimethyl-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 174911104 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | bis(prop-2-enoic acid);3,3,4-trimethyl-2-methylidenepentanoic acid |
| SMILES | C=C(C(=O)O)C(C)(C)C(C)C.C=CC(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C9H16O2.2C3H4O2/c1-6(2)9(4,5)7(3)8(10)11;2*1-2-3(4)5/h6H,3H2,1-2,4-5H3,(H,10,11);2*2H,1H2,(H,4,5) |
| InChIKey | CXYHGNHDKPWLIB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|