C14H24O4 — CID 174780645
tert-butyl 3,3-dimethyl-2-methylidenebutanoate;prop-2-enoic acid (PubChem CID 174780645) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-2-methylidenebutanoate;prop-2-enoic acid.
| Compound Name | tert-butyl 3,3-dimethyl-2-methylidenebutanoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174780645 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | tert-butyl 3,3-dimethyl-2-methylidenebutanoate;prop-2-enoic acid |
| SMILES | C=C(C(=O)OC(C)(C)C)C(C)(C)C.C=CC(=O)O |
| InChI | InChI=1S/C11H20O2.C3H4O2/c1-8(10(2,3)4)9(12)13-11(5,6)7;1-2-3(4)5/h1H2,2-7H3;2H,1H2,(H,4,5) |
| InChIKey | RQAYYWJHNBQNOK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|