C12H17BrO2 — CID 170757348
tert-butyl (2Z)-3-bromo-2-prop-1-en-2-ylpenta-2,4-dienoate (PubChem CID 170757348) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is tert-butyl (2Z)-3-bromo-2-prop-1-en-2-ylpenta-2,4-dienoate.
| Compound Name | tert-butyl (2Z)-3-bromo-2-prop-1-en-2-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 170757348 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | tert-butyl (2Z)-3-bromo-2-prop-1-en-2-ylpenta-2,4-dienoate |
| SMILES | C=C/C(Br)=C(\C(=C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17BrO2/c1-7-9(13)10(8(2)3)11(14)15-12(4,5)6/h7H,1-2H2,3-6H3/b10-9- |
| InChIKey | AFPDICALUIPXIN-KTKRTIGZSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|