C15H28O4Si — CID 86753515
tert-butyl 2-methylprop-2-enoate;trimethylsilylmethyl prop-2-enoate (PubChem CID 86753515) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-enoate;trimethylsilylmethyl prop-2-enoate.
| Compound Name | tert-butyl 2-methylprop-2-enoate;trimethylsilylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 86753515 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | tert-butyl 2-methylprop-2-enoate;trimethylsilylmethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C.C=CC(=O)OC[Si](C)(C)C |
| InChI | InChI=1S/C8H14O2.C7H14O2Si/c1-6(2)7(9)10-8(3,4)5;1-5-7(8)9-6-10(2,3)4/h1H2,2-5H3;5H,1,6H2,2-4H3 |
| InChIKey | GZWZCJPGNDVZOI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|