C24H42O6 — CID 174799146
tert-butyl 2-methylprop-2-enoate;tert-butyl prop-2-enoate;hexyl prop-2-enoate (PubChem CID 174799146) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-enoate;tert-butyl prop-2-enoate;hexyl prop-2-enoate.
| Compound Name | tert-butyl 2-methylprop-2-enoate;tert-butyl prop-2-enoate;hexyl prop-2-enoate |
|---|---|
| PubChem CID | 174799146 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | tert-butyl 2-methylprop-2-enoate;tert-butyl prop-2-enoate;hexyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C.C=CC(=O)OC(C)(C)C.C=CC(=O)OCCCCCC |
| InChI | InChI=1S/C9H16O2.C8H14O2.C7H12O2/c1-3-5-6-7-8-11-9(10)4-2;1-6(2)7(9)10-8(3,4)5;1-5-6(8)9-7(2,3)4/h4H,2-3,5-8H2,1H3;1H2,2-5H3;5H,1H2,2-4H3 |
| InChIKey | PYXCKELSQOLJSE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|