C11H18O4Si — CID 150664135
[dimethyl(prop-2-enoyloxymethyl)silyl]methyl 2-methylprop-2-enoate (PubChem CID 150664135) has the molecular formula C11H18O4Si and a molecular weight of 242.35 g/mol. Its IUPAC name is [dimethyl(prop-2-enoyloxymethyl)silyl]methyl 2-methylprop-2-enoate.
| Compound Name | [dimethyl(prop-2-enoyloxymethyl)silyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150664135 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | [dimethyl(prop-2-enoyloxymethyl)silyl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC[Si](C)(C)COC(=O)C(=C)C |
| InChI | InChI=1S/C11H18O4Si/c1-6-10(12)14-7-16(4,5)8-15-11(13)9(2)3/h6H,1-2,7-8H2,3-5H3 |
| InChIKey | JEMSSIILBOQHCG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|