About tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid
tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid (PubChem CID 174963265) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid |
| PubChem CID | 174963265 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(C)(C)OC(=O)/C=C\C#N |
| InChI | InChI=1S/C8H11NO2.C3H4O2/c1-8(2,3)11-7(10)5-4-6-9;1-2-3(4)5/h4-5H,1-3H3;2H,1H2,(H,4,5)/b5-4-; |
| InChIKey | UFJWEDLFBIDDFI-MKWAYWHRSA-N |
| XLogP | 1.66 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid?
The IUPAC name of tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid (CID 174963265) is tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid?
The canonical SMILES for tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid is C=CC(=O)O.CC(C)(C)OC(=O)/C=C\C#N.
What is the InChIKey of tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid?
The InChIKey is UFJWEDLFBIDDFI-MKWAYWHRSA-N. The full InChI is InChI=1S/C8H11NO2.C3H4O2/c1-8(2,3)11-7(10)5-4-6-9;1-2-3(4)5/h4-5H,1-3H3;2H,1H2,(H,4,5)/b5-4-;.
What are the key properties of tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid?
tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid has a molecular weight of 225.24 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (Z)-3-cyanoprop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 174963265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).