C17H28O4 — CID 174857301
tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 174857301) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174857301 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(=CC1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24O2.C3H4O2/c1-11(13(15)16-14(2,3)4)10-12-8-6-5-7-9-12;1-2-3(4)5/h10,12H,5-9H2,1-4H3;2H,1H2,(H,4,5) |
| InChIKey | NELLFQIVCIICRN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|