C15H24O4 — CID 67876019
(E)-3-cyclohexyl-2-methylprop-2-enoic acid;(E)-2-methylbut-2-enoic acid (PubChem CID 67876019) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (E)-3-cyclohexyl-2-methylprop-2-enoic acid;(E)-2-methylbut-2-enoic acid.
| Compound Name | (E)-3-cyclohexyl-2-methylprop-2-enoic acid;(E)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 67876019 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (E)-3-cyclohexyl-2-methylprop-2-enoic acid;(E)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\C1CCCCC1)C(=O)O.C/C=C(\C)C(=O)O |
| InChI | InChI=1S/C10H16O2.C5H8O2/c1-8(10(11)12)7-9-5-3-2-4-6-9;1-3-4(2)5(6)7/h7,9H,2-6H2,1H3,(H,11,12);3H,1-2H3,(H,6,7)/b8-7+;4-3+ |
| InChIKey | AEGROEANHRQANH-KGHXOJBXSA-N |
| XLogP | 3.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|