C19H32O2 — CID 67084322
3-[4-(2-cyclohexylpropan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid (PubChem CID 67084322) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 3-[4-(2-cyclohexylpropan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-(2-cyclohexylpropan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67084322 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 3-[4-(2-cyclohexylpropan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1CCC(C(C)(C)C2CCCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C19H32O2/c1-14(18(20)21)13-15-9-11-17(12-10-15)19(2,3)16-7-5-4-6-8-16/h13,15-17H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | VZXMYKDFYWQUSO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|