C27H46O4 — CID 155169215
tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;tert-butyl 2-cyclohexylprop-2-enoate (PubChem CID 155169215) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;tert-butyl 2-cyclohexylprop-2-enoate.
| Compound Name | tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;tert-butyl 2-cyclohexylprop-2-enoate |
|---|---|
| PubChem CID | 155169215 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | tert-butyl 3-cyclohexyl-2-methylprop-2-enoate;tert-butyl 2-cyclohexylprop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C1CCCCC1.CC(=CC1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24O2.C13H22O2/c1-11(13(15)16-14(2,3)4)10-12-8-6-5-7-9-12;1-10(11-8-6-5-7-9-11)12(14)15-13(2,3)4/h10,12H,5-9H2,1-4H3;11H,1,5-9H2,2-4H3 |
| InChIKey | GVGPECOGDSAJLD-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|