C13H20O4 — CID 174844739
2,3,4,5,5-pentamethyl-6-methylidenehept-2-enedioic acid (PubChem CID 174844739) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2,3,4,5,5-pentamethyl-6-methylidenehept-2-enedioic acid.
| Compound Name | 2,3,4,5,5-pentamethyl-6-methylidenehept-2-enedioic acid |
|---|---|
| PubChem CID | 174844739 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2,3,4,5,5-pentamethyl-6-methylidenehept-2-enedioic acid |
| SMILES | C=C(C(=O)O)C(C)(C)C(C)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-7(8(2)11(14)15)9(3)13(5,6)10(4)12(16)17/h9H,4H2,1-3,5-6H3,(H,14,15)(H,16,17) |
| InChIKey | LIRGKGDWFKGOJW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|