About 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid)
2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) (PubChem CID 87459377) has the molecular formula C9H12O7
and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid).
Molecular Properties
| Compound Name | 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) |
| PubChem CID | 87459377 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) |
| SMILES | C=C(O)C(=O)O.C=CC(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C3H4O3.2C3H4O2/c1-2(4)3(5)6;2*1-2-3(4)5/h4H,1H2,(H,5,6);2*2H,1H2,(H,4,5) |
| InChIKey | HQDZHMMYDFPMFU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid)?
The IUPAC name of 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) (CID 87459377) is 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid).
What is the SMILES notation for 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid)?
The canonical SMILES for 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) is C=C(O)C(=O)O.C=CC(=O)O.C=CC(=O)O.
What is the InChIKey of 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid)?
The InChIKey is HQDZHMMYDFPMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.2C3H4O2/c1-2(4)3(5)6;2*1-2-3(4)5/h4H,1H2,(H,5,6);2*2H,1H2,(H,4,5).
What are the key properties of 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid)?
2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) has a molecular weight of 232.19 g/mol, XLogP of 0.66, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyprop-2-enoic acid;bis(prop-2-enoic acid) is sourced from PubChem (CID 87459377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).