C18H25P — CID 134462409
[(3E)-hexa-1,3,5-trien-3-yl]-[(4E,5Z)-3-methyl-4-prop-2-enylideneocta-5,7-dien-3-yl]phosphane (PubChem CID 134462409) has the molecular formula C18H25P and a molecular weight of 272.37 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]-[(4E,5Z)-3-methyl-4-prop-2-enylideneocta-5,7-dien-3-yl]phosphane.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]-[(4E,5Z)-3-methyl-4-prop-2-enylideneocta-5,7-dien-3-yl]phosphane |
|---|---|
| PubChem CID | 134462409 |
| Molecular Formula | C18H25P |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]-[(4E,5Z)-3-methyl-4-prop-2-enylideneocta-5,7-dien-3-yl]phosphane |
| SMILES | C=C/C=C\C(=C/C=C)C(C)(CC)P/C(C=C)=C/C=C |
| InChI | InChI=1S/C18H25P/c1-7-12-15-16(13-8-2)18(6,11-5)19-17(10-4)14-9-3/h7-10,12-15,19H,1-4,11H2,5-6H3/b15-12-,16-13+,17-14+ |
| InChIKey | GLXCQAXJKBMMLE-PDRHLSLFSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|