C10H15B — CID 174032473
dimethyl-[(3Z,5Z)-octa-1,3,5,7-tetraen-4-yl]borane (PubChem CID 174032473) has the molecular formula C10H15B and a molecular weight of 146.04 g/mol. Its IUPAC name is dimethyl-[(3Z,5Z)-octa-1,3,5,7-tetraen-4-yl]borane.
| Compound Name | dimethyl-[(3Z,5Z)-octa-1,3,5,7-tetraen-4-yl]borane |
|---|---|
| PubChem CID | 174032473 |
| Molecular Formula | C10H15B |
| Molecular Weight | 146.04 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | dimethyl-[(3Z,5Z)-octa-1,3,5,7-tetraen-4-yl]borane |
| SMILES | C=C/C=C\C(=C/C=C)B(C)C |
| InChI | InChI=1S/C10H15B/c1-5-7-9-10(8-6-2)11(3)4/h5-9H,1-2H2,3-4H3/b9-7-,10-8+ |
| InChIKey | XBEGZBPXUILPHP-FKJILZIQSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|