C12H24N2 — CID 143703879
ethane;[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine (PubChem CID 143703879) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine.
| Compound Name | ethane;[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine |
|---|---|
| PubChem CID | 143703879 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine |
| SMILES | C=C/C=C\C(=C/C=C)NN.CC.CC |
| InChI | InChI=1S/C8H12N2.2C2H6/c1-3-5-7-8(10-9)6-4-2;2*1-2/h3-7,10H,1-2,9H2;2*1-2H3/b7-5-,8-6+;; |
| InChIKey | ZNANJNZCTGXZIB-RRBJLESWSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|