C9H18N2 — CID 154694303
ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]hydrazine (PubChem CID 154694303) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]hydrazine.
| Compound Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 154694303 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]hydrazine |
| SMILES | C=C/C=C\C(=C/C)NN.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-3-5-6-7(4-2)9-8;1-2/h3-6,9H,1,8H2,2H3;1-2H3/b6-5-,7-4+; |
| InChIKey | YPTVCYIMOVBBTK-BIFKCLKRSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|