C11H21N — CID 144790327
(2E,4Z)-N-methylhepta-2,4,6-trien-3-amine;propane (PubChem CID 144790327) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2E,4Z)-N-methylhepta-2,4,6-trien-3-amine;propane.
| Compound Name | (2E,4Z)-N-methylhepta-2,4,6-trien-3-amine;propane |
|---|---|
| PubChem CID | 144790327 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2E,4Z)-N-methylhepta-2,4,6-trien-3-amine;propane |
| SMILES | C=C/C=C\C(=C/C)NC.CCC |
| InChI | InChI=1S/C8H13N.C3H8/c1-4-6-7-8(5-2)9-3;1-3-2/h4-7,9H,1H2,2-3H3;3H2,1-2H3/b7-6-,8-5+; |
| InChIKey | YTAIOUGQURABPR-LAPANCLDSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|