C15H25N — CID 154957795
(E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methylhept-3-en-3-amine (PubChem CID 154957795) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methylhept-3-en-3-amine.
| Compound Name | (E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methylhept-3-en-3-amine |
|---|---|
| PubChem CID | 154957795 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methylhept-3-en-3-amine |
| SMILES | C=C/C=C\C(=C/C)N/C(=C/CCC)C(C)C |
| InChI | InChI=1S/C15H25N/c1-6-9-11-14(8-3)16-15(13(4)5)12-10-7-2/h6,8-9,11-13,16H,1,7,10H2,2-5H3/b11-9-,14-8+,15-12+ |
| InChIKey | IFLCWPIQYHKXCF-DIBIQGHZSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|