C11H18O2S — CID 91528996
5-ethylsulfonylnona-1,3,5-triene (PubChem CID 91528996) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 5-ethylsulfonylnona-1,3,5-triene.
| Compound Name | 5-ethylsulfonylnona-1,3,5-triene |
|---|---|
| PubChem CID | 91528996 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-ethylsulfonylnona-1,3,5-triene |
| SMILES | C=CC=CC(=CCCC)S(=O)(=O)CC |
| InChI | InChI=1S/C11H18O2S/c1-4-7-9-11(10-8-5-2)14(12,13)6-3/h4,7,9-10H,1,5-6,8H2,2-3H3 |
| InChIKey | JJQZDTHNCZQCAH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|