C7H12O — CID 102117961
(3Z)-hepta-1,3-dien-3-ol (PubChem CID 102117961) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is (3Z)-hepta-1,3-dien-3-ol.
| Compound Name | (3Z)-hepta-1,3-dien-3-ol |
|---|---|
| PubChem CID | 102117961 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (3Z)-hepta-1,3-dien-3-ol |
| SMILES | C=C/C(O)=C/CCC |
| InChI | InChI=1S/C7H12O/c1-3-5-6-7(8)4-2/h4,6,8H,2-3,5H2,1H3/b7-6- |
| InChIKey | RLOGFVRYJHPFNA-SREVYHEPSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|