C7H11Cl — CID 88589148
(3E)-3-chlorohepta-1,3-diene (PubChem CID 88589148) has the molecular formula C7H11Cl and a molecular weight of 130.62 g/mol. Its IUPAC name is (3E)-3-chlorohepta-1,3-diene.
| Compound Name | (3E)-3-chlorohepta-1,3-diene |
|---|---|
| PubChem CID | 88589148 |
| Molecular Formula | C7H11Cl |
| Molecular Weight | 130.62 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (3E)-3-chlorohepta-1,3-diene |
| SMILES | C=C/C(Cl)=C\CCC |
| InChI | InChI=1S/C7H11Cl/c1-3-5-6-7(8)4-2/h4,6H,2-3,5H2,1H3/b7-6+ |
| InChIKey | NYXWUEXVUVKCFX-VOTSOKGWSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|