C13H25ClN2 — CID 143004492
(3E)-3-chlorohepta-1,3-diene;2-ethylpiperazine (PubChem CID 143004492) has the molecular formula C13H25ClN2 and a molecular weight of 244.81 g/mol. Its IUPAC name is (3E)-3-chlorohepta-1,3-diene;2-ethylpiperazine.
| Compound Name | (3E)-3-chlorohepta-1,3-diene;2-ethylpiperazine |
|---|---|
| PubChem CID | 143004492 |
| Molecular Formula | C13H25ClN2 |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (3E)-3-chlorohepta-1,3-diene;2-ethylpiperazine |
| SMILES | C=C/C(Cl)=C\CCC.CCC1CNCCN1 |
| InChI | InChI=1S/C7H11Cl.C6H14N2/c1-3-5-6-7(8)4-2;1-2-6-5-7-3-4-8-6/h4,6H,2-3,5H2,1H3;6-8H,2-5H2,1H3/b7-6+; |
| InChIKey | VJUCLEIMEXJBFP-UHDJGPCESA-N |
| XLogP | 3.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|