About tert-butyl formate;(2S)-2-ethylpiperazine
tert-butyl formate;(2S)-2-ethylpiperazine (PubChem CID 174740431) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl formate;(2S)-2-ethylpiperazine.
Molecular Properties
| Compound Name | tert-butyl formate;(2S)-2-ethylpiperazine |
| PubChem CID | 174740431 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | tert-butyl formate;(2S)-2-ethylpiperazine |
| SMILES | CC(C)(C)OC=O.CC[C@H]1CNCCN1 |
| InChI | InChI=1S/C6H14N2.C5H10O2/c1-2-6-5-7-3-4-8-6;1-5(2,3)7-4-6/h6-8H,2-5H2,1H3;4H,1-3H3/t6-;/m0./s1 |
| InChIKey | QGGYGBRIRIALHT-RGMNGODLSA-N |
| XLogP | 0.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;(2S)-2-ethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;(2S)-2-ethylpiperazine?
The IUPAC name of tert-butyl formate;(2S)-2-ethylpiperazine (CID 174740431) is tert-butyl formate;(2S)-2-ethylpiperazine.
What is the SMILES notation for tert-butyl formate;(2S)-2-ethylpiperazine?
The canonical SMILES for tert-butyl formate;(2S)-2-ethylpiperazine is CC(C)(C)OC=O.CC[C@H]1CNCCN1.
What is the InChIKey of tert-butyl formate;(2S)-2-ethylpiperazine?
The InChIKey is QGGYGBRIRIALHT-RGMNGODLSA-N. The full InChI is InChI=1S/C6H14N2.C5H10O2/c1-2-6-5-7-3-4-8-6;1-5(2,3)7-4-6/h6-8H,2-5H2,1H3;4H,1-3H3/t6-;/m0./s1.
What are the key properties of tert-butyl formate;(2S)-2-ethylpiperazine?
tert-butyl formate;(2S)-2-ethylpiperazine has a molecular weight of 216.32 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;(2S)-2-ethylpiperazine is sourced from PubChem (CID 174740431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).