C7H10Cl2 — CID 154209919
1,3-dichlorohepta-1,3-diene (PubChem CID 154209919) has the molecular formula C7H10Cl2 and a molecular weight of 165.06 g/mol. Its IUPAC name is 1,3-dichlorohepta-1,3-diene.
| Compound Name | 1,3-dichlorohepta-1,3-diene |
|---|---|
| PubChem CID | 154209919 |
| Molecular Formula | C7H10Cl2 |
| Molecular Weight | 165.06 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 1,3-dichlorohepta-1,3-diene |
| SMILES | CCCC=C(Cl)C=CCl |
| InChI | InChI=1S/C7H10Cl2/c1-2-3-4-7(9)5-6-8/h4-6H,2-3H2,1H3 |
| InChIKey | UWVTXWSEMOAKEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|