About 2-chlorohex-2-en-1-ol
2-chlorohex-2-en-1-ol (PubChem CID 130125414) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is 2-chlorohex-2-en-1-ol.
Molecular Properties
| Compound Name | 2-chlorohex-2-en-1-ol |
| PubChem CID | 130125414 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 2-chlorohex-2-en-1-ol |
| SMILES | CCCC=C(Cl)CO |
| InChI | InChI=1S/C6H11ClO/c1-2-3-4-6(7)5-8/h4,8H,2-3,5H2,1H3 |
| InChIKey | MZZQWZRZHJVAAB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chlorohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorohex-2-en-1-ol?
The IUPAC name of 2-chlorohex-2-en-1-ol (CID 130125414) is 2-chlorohex-2-en-1-ol.
What is the SMILES notation for 2-chlorohex-2-en-1-ol?
The canonical SMILES for 2-chlorohex-2-en-1-ol is CCCC=C(Cl)CO.
What is the InChIKey of 2-chlorohex-2-en-1-ol?
The InChIKey is MZZQWZRZHJVAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO/c1-2-3-4-6(7)5-8/h4,8H,2-3,5H2,1H3.
What are the key properties of 2-chlorohex-2-en-1-ol?
2-chlorohex-2-en-1-ol has a molecular weight of 134.61 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorohex-2-en-1-ol is sourced from PubChem (CID 130125414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).