About (Z)-2-bromohex-2-en-1-ol
(Z)-2-bromohex-2-en-1-ol (PubChem CID 23238559) has the molecular formula C6H11BrO
and a molecular weight of 179.06 g/mol. Its IUPAC name is (Z)-2-bromohex-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-2-bromohex-2-en-1-ol |
| PubChem CID | 23238559 |
| Molecular Formula | C6H11BrO |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | (Z)-2-bromohex-2-en-1-ol |
| SMILES | CCC/C=C(\Br)CO |
| InChI | InChI=1S/C6H11BrO/c1-2-3-4-6(7)5-8/h4,8H,2-3,5H2,1H3/b6-4- |
| InChIKey | OKCZKINPRQDHCG-XQRVVYSFSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-2-bromohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-bromohex-2-en-1-ol?
The IUPAC name of (Z)-2-bromohex-2-en-1-ol (CID 23238559) is (Z)-2-bromohex-2-en-1-ol.
What is the SMILES notation for (Z)-2-bromohex-2-en-1-ol?
The canonical SMILES for (Z)-2-bromohex-2-en-1-ol is CCC/C=C(\Br)CO.
What is the InChIKey of (Z)-2-bromohex-2-en-1-ol?
The InChIKey is OKCZKINPRQDHCG-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H11BrO/c1-2-3-4-6(7)5-8/h4,8H,2-3,5H2,1H3/b6-4-.
What are the key properties of (Z)-2-bromohex-2-en-1-ol?
(Z)-2-bromohex-2-en-1-ol has a molecular weight of 179.06 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-bromohex-2-en-1-ol is sourced from PubChem (CID 23238559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).