C11H22 — CID 176669998
ethane;(2Z,4Z)-4-methylocta-2,4-diene (PubChem CID 176669998) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is ethane;(2Z,4Z)-4-methylocta-2,4-diene.
| Compound Name | ethane;(2Z,4Z)-4-methylocta-2,4-diene |
|---|---|
| PubChem CID | 176669998 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | ethane;(2Z,4Z)-4-methylocta-2,4-diene |
| SMILES | C/C=C\C(C)=C/CCC.CC |
| InChI | InChI=1S/C9H16.C2H6/c1-4-6-8-9(3)7-5-2;1-2/h5,7-8H,4,6H2,1-3H3;1-2H3/b7-5-,9-8-; |
| InChIKey | NGWVGRLBRKTASD-KAVWWGJUSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|