C17H38 — CID 142057667
(Z)-but-2-ene;ethane;(2Z,4Z)-3-methylhexa-2,4-diene (PubChem CID 142057667) has the molecular formula C17H38 and a molecular weight of 242.49 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;(2Z,4Z)-3-methylhexa-2,4-diene.
| Compound Name | (Z)-but-2-ene;ethane;(2Z,4Z)-3-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 142057667 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | (Z)-but-2-ene;ethane;(2Z,4Z)-3-methylhexa-2,4-diene |
| SMILES | C/C=C\C.C/C=C\C(C)=C/C.CC.CC.CC |
| InChI | InChI=1S/C7H12.C4H8.3C2H6/c1-4-6-7(3)5-2;1-3-4-2;3*1-2/h4-6H,1-3H3;3-4H,1-2H3;3*1-2H3/b6-4-,7-5-;4-3-;;; |
| InChIKey | KSAHZJNTQJIGDL-OFBQYRKASA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|