C10H19N — CID 143375975
ethane;(3E,5Z)-4-methylhepta-1,3,5-trien-2-amine (PubChem CID 143375975) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-methylhepta-1,3,5-trien-2-amine.
| Compound Name | ethane;(3E,5Z)-4-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143375975 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | ethane;(3E,5Z)-4-methylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(C)/C=C\C.CC |
| InChI | InChI=1S/C8H13N.C2H6/c1-4-5-7(2)6-8(3)9;1-2/h4-6H,3,9H2,1-2H3;1-2H3/b5-4-,7-6+; |
| InChIKey | VFEVZKKOQGOSMD-YLKXMWBMSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|