C12H26 — CID 143006667
ethane;ethene;(3Z)-2-methylpenta-1,3-diene (PubChem CID 143006667) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is ethane;ethene;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | ethane;ethene;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 143006667 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | ethane;ethene;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C.C=C(C)/C=C\C.CC.CC |
| InChI | InChI=1S/C6H10.2C2H6.C2H4/c1-4-5-6(2)3;3*1-2/h4-5H,2H2,1,3H3;2*1-2H3;1-2H2/b5-4-;;; |
| InChIKey | NXODGIPJWNEHJT-OAWHIZORSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|