C8H16 — CID 142023424
ethane;(3Z)-2-methylpenta-1,3-diene (PubChem CID 142023424) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is ethane;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | ethane;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 142023424 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | ethane;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C=C\C.CC |
| InChI | InChI=1S/C6H10.C2H6/c1-4-5-6(2)3;1-2/h4-5H,2H2,1,3H3;1-2H3/b5-4-; |
| InChIKey | LKSYVFWHEGZOKX-MKWAYWHRSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|