C10H17Br — CID 144637545
(3Z,5E)-5-bromo-2-methylhepta-1,3,5-triene;ethane (PubChem CID 144637545) has the molecular formula C10H17Br and a molecular weight of 217.15 g/mol. Its IUPAC name is (3Z,5E)-5-bromo-2-methylhepta-1,3,5-triene;ethane.
| Compound Name | (3Z,5E)-5-bromo-2-methylhepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 144637545 |
| Molecular Formula | C10H17Br |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (3Z,5E)-5-bromo-2-methylhepta-1,3,5-triene;ethane |
| SMILES | C=C(C)/C=C\C(Br)=C/C.CC |
| InChI | InChI=1S/C8H11Br.C2H6/c1-4-8(9)6-5-7(2)3;1-2/h4-6H,2H2,1,3H3;1-2H3/b6-5-,8-4+; |
| InChIKey | MLCQYYUADJWMRO-KCWJKURDSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|