C7H10BrN — CID 156548743
(3Z,5E)-5-bromohepta-3,5-dien-2-imine (PubChem CID 156548743) has the molecular formula C7H10BrN and a molecular weight of 188.07 g/mol. Its IUPAC name is (3Z,5E)-5-bromohepta-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-5-bromohepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 156548743 |
| Molecular Formula | C7H10BrN |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | (3Z,5E)-5-bromohepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(Br)=C/C |
| InChI | InChI=1S/C7H10BrN/c1-3-7(8)5-4-6(2)9/h3-5,9H,1-2H3/b5-4-,7-3+,9-6+ |
| InChIKey | MBFCCPMYVAALSU-OHOQQYMSSA-N |
| XLogP | 2.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|